3-methylbutanoic anhydride


isovaleric anhydride; 3-methylbutanoic anhydride; β-methyl-n-butyric anhydride; β-methylbutyric anhydride
CAS RN:[1468-39-9]
Formula:C10H18O3; 186.25 g/mol
InChiKey:FREZLSIGWNCSOQ-UHFFFAOYSA-N
SMILES:CC(C)CC(=O)OC(=O)CC(C)C
Molecular structure of 3-methylbutanoic anhydride
Density:0.933 g/mL
Molar volume:199.6 mL/mol
Refractive index:1.404
Molecular refractive power:48.82 mL/mol
Melting point:-65 °C
Boiling point:215 °C

Isomers

cyclobutyrol
Molecular structure of cyclobutyrol
2-cyclohexyloxy-2-methylpropanoic acid
Molecular structure of 2-cyclohexyloxy-2-methylpropanoic acid
5,5-dimethyl-1,3-dioxane-2-butanal
Molecular structure of 5,5-dimethyl-1,3-dioxane-2-butanal
epomediol
Molecular structure of epomediol
ethyl 2-acetylhexanoate
Molecular structure of ethyl 2-acetylhexanoate
ethyl 2,2-diethyl-3-oxobutanoate
Molecular structure of ethyl 2,2-diethyl-3-oxobutanoate
ethyl 3-oxooctanoate
Molecular structure of ethyl 3-oxooctanoate
3-methylbutanoic anhydride
Molecular structure of 3-methylbutanoic anhydride
3-methylbutyl 4-oxopentanoate
Molecular structure of 3-methylbutyl 4-oxopentanoate
methyl (Z)-3-methoxy-2-octenoate
Molecular structure of methyl (Z)-3-methoxy-2-octenoate
pentanoic anhydride
Molecular structure of pentanoic anhydride
pentyl 4-oxopentanoate
Molecular structure of pentyl 4-oxopentanoate
trimethylacetic anhydride
Molecular structure of trimethylacetic anhydride